C25H30N10O2 — CID 169210544
4-[4-[[(3R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperidin-3-yl]methyl]piperazin-1-yl]benzamide (PubChem CID 169210544) has the molecular formula C25H30N10O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 4-[4-[[(3R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperidin-3-yl]methyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[[(3R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperidin-3-yl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 169210544 |
| Molecular Formula | C25H30N10O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-[4-[[(3R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperidin-3-yl]methyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C[C@H]3CCCN(c4nc(N)n5nc(-c6ccco6)nc5n4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H30N10O2/c26-21(36)18-5-7-19(8-6-18)33-12-10-32(11-13-33)15-17-3-1-9-34(16-17)24-29-23(27)35-25(30-24)28-22(31-35)20-4-2-14-37-20/h2,4-8,14,17H,1,3,9-13,15-16H2,(H2,26,36)(H2,27,28,29,30,31)/t17-/m1/s1 |
| InChIKey | JNBVZEVLTKCKIL-QGZVFWFLSA-N |
| XLogP | 1.50 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |