C20H21Cl2N9O — CID 69312242
6-[2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 69312242) has the molecular formula C20H21Cl2N9O and a molecular weight of 474.36 g/mol. Its IUPAC name is 6-[2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 6-[2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 69312242 |
| Molecular Formula | C20H21Cl2N9O |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 6-[2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | Nc1nc2nc(-c3ccco3)nn2c(N)c1CCN1CCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H21Cl2N9O/c21-12-10-14(22)19(25-11-12)30-7-5-29(6-8-30)4-3-13-16(23)26-20-27-18(15-2-1-9-32-15)28-31(20)17(13)24/h1-2,9-11H,3-8,24H2,(H2,23,26,27,28) |
| InChIKey | UDONCNBIJMCJQM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |