C13H16N6O3 — CID 69312099
6-(2,2-dimethoxyethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 69312099) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 6-(2,2-dimethoxyethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 6-(2,2-dimethoxyethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 69312099 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-(2,2-dimethoxyethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | COC(Cc1c(N)nc2nc(-c3ccco3)nn2c1N)OC |
| InChI | InChI=1S/C13H16N6O3/c1-20-9(21-2)6-7-10(14)16-13-17-12(8-4-3-5-22-8)18-19(13)11(7)15/h3-5,9H,6,15H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | XZNCXPASDYUQGM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|