C21H21F2N7O — CID 69309423
6-[2-(2,5-difluorophenyl)-1-pyrrolidin-2-ylethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 69309423) has the molecular formula C21H21F2N7O and a molecular weight of 425.44 g/mol. Its IUPAC name is 6-[2-(2,5-difluorophenyl)-1-pyrrolidin-2-ylethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 6-[2-(2,5-difluorophenyl)-1-pyrrolidin-2-ylethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 69309423 |
| Molecular Formula | C21H21F2N7O |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 6-[2-(2,5-difluorophenyl)-1-pyrrolidin-2-ylethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | Nc1nc2nc(-c3ccco3)nn2c(N)c1C(Cc1cc(F)ccc1F)C1CCCN1 |
| InChI | InChI=1S/C21H21F2N7O/c22-12-5-6-14(23)11(9-12)10-13(15-3-1-7-26-15)17-18(24)27-21-28-20(16-4-2-8-31-16)29-30(21)19(17)25/h2,4-6,8-9,13,15,26H,1,3,7,10,25H2,(H2,24,27,28,29) |
| InChIKey | RRCYNTHGLKMWSE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |