C17H20N8O4 — CID 51051035
methyl 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]-4-oxobutanoate (PubChem CID 51051035) has the molecular formula C17H20N8O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is methyl 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 51051035 |
| Molecular Formula | C17H20N8O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C17H20N8O4/c1-28-13(27)5-4-12(26)23-6-8-24(9-7-23)16-20-15(18)25-17(21-16)19-14(22-25)11-3-2-10-29-11/h2-3,10H,4-9H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | NQDDUYJVXZFFQT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |