C14H18N8O — CID 69432575
5-(2-ethylpiperazin-1-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 69432575) has the molecular formula C14H18N8O and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-(2-ethylpiperazin-1-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-(2-ethylpiperazin-1-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 69432575 |
| Molecular Formula | C14H18N8O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-(2-ethylpiperazin-1-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | CCC1CNCCN1c1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C14H18N8O/c1-2-9-8-16-5-6-21(9)13-18-12(15)22-14(19-13)17-11(20-22)10-4-3-7-23-10/h3-4,7,9,16H,2,5-6,8H2,1H3,(H2,15,17,18,19,20) |
| InChIKey | IOAIRZMBZGGAIZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |