C18H21F2N9O2 — CID 171744767
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]azetidin-2-yl]-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone (PubChem CID 171744767) has the molecular formula C18H21F2N9O2 and a molecular weight of 433.42 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]azetidin-2-yl]-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]azetidin-2-yl]-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171744767 |
| Molecular Formula | C18H21F2N9O2 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]azetidin-2-yl]-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone |
| SMILES | Nc1nc(N2CC[C@H]2C(=O)N2CCN(CC(F)F)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H21F2N9O2/c19-13(20)10-26-5-7-27(8-6-26)15(30)11-3-4-28(11)17-23-16(21)29-18(24-17)22-14(25-29)12-2-1-9-31-12/h1-2,9,11,13H,3-8,10H2,(H2,21,22,23,24,25)/t11-/m0/s1 |
| InChIKey | PEZGNAUDLRYYRU-NSHDSACASA-N |
| XLogP | 0.35 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |