C23H22FN9O3 — CID 171744722
4-[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidine-2-carbonyl]-1-(4-fluorophenyl)piperazin-2-one (PubChem CID 171744722) has the molecular formula C23H22FN9O3 and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidine-2-carbonyl]-1-(4-fluorophenyl)piperazin-2-one.
| Compound Name | 4-[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidine-2-carbonyl]-1-(4-fluorophenyl)piperazin-2-one |
|---|---|
| PubChem CID | 171744722 |
| Molecular Formula | C23H22FN9O3 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 4-[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidine-2-carbonyl]-1-(4-fluorophenyl)piperazin-2-one |
| SMILES | Nc1nc(N2CCC[C@H]2C(=O)N2CCN(c3ccc(F)cc3)C(=O)C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H22FN9O3/c24-14-5-7-15(8-6-14)31-11-10-30(13-18(31)34)20(35)16-3-1-9-32(16)22-27-21(25)33-23(28-22)26-19(29-33)17-4-2-12-36-17/h2,4-8,12,16H,1,3,9-11,13H2,(H2,25,26,27,28,29)/t16-/m0/s1 |
| InChIKey | DHXSEZSXZINHAZ-INIZCTEOSA-N |
| XLogP | 1.34 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |