C22H28N10O4 — CID 171744961
[(2R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(morpholine-4-carbonyl)piperazin-1-yl]methanone (PubChem CID 171744961) has the molecular formula C22H28N10O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is [(2R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(morpholine-4-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [(2R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(morpholine-4-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171744961 |
| Molecular Formula | C22H28N10O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | [(2R)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(morpholine-4-carbonyl)piperazin-1-yl]methanone |
| SMILES | Nc1nc(N2CCC[C@@H]2C(=O)N2CCN(C(=O)N3CCOCC3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H28N10O4/c23-19-25-20(26-21-24-17(27-32(19)21)16-4-2-12-36-16)31-5-1-3-15(31)18(33)28-6-8-29(9-7-28)22(34)30-10-13-35-14-11-30/h2,4,12,15H,1,3,5-11,13-14H2,(H2,23,24,25,26,27)/t15-/m1/s1 |
| InChIKey | ZXAQGFBCYXJBHG-OAHLLOKOSA-N |
| XLogP | -0.07 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |