C23H31N9O2 — CID 174296304
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[(1-methylcyclobutyl)methyl]piperazin-1-yl]methanone (PubChem CID 174296304) has the molecular formula C23H31N9O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[(1-methylcyclobutyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[(1-methylcyclobutyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174296304 |
| Molecular Formula | C23H31N9O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[(1-methylcyclobutyl)methyl]piperazin-1-yl]methanone |
| SMILES | CC1(CN2CCN(C(=O)[C@@H]3CCCN3c3nc(N)n4nc(-c5ccco5)nc4n3)CC2)CCC1 |
| InChI | InChI=1S/C23H31N9O2/c1-23(7-4-8-23)15-29-10-12-30(13-11-29)19(33)16-5-2-9-31(16)21-26-20(24)32-22(27-21)25-18(28-32)17-6-3-14-34-17/h3,6,14,16H,2,4-5,7-13,15H2,1H3,(H2,24,25,26,27,28)/t16-/m0/s1 |
| InChIKey | LWRFZNVGMNTMKX-INIZCTEOSA-N |
| XLogP | 1.66 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |