C21H27F2N9O2 — CID 171744814
[(2S)-1-[7-amino-2-(5-methylfuran-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(2,2-difluoropropyl)piperazin-1-yl]methanone (PubChem CID 171744814) has the molecular formula C21H27F2N9O2 and a molecular weight of 475.50 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(5-methylfuran-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(2,2-difluoropropyl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(5-methylfuran-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(2,2-difluoropropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171744814 |
| Molecular Formula | C21H27F2N9O2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | [(2S)-1-[7-amino-2-(5-methylfuran-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-(2,2-difluoropropyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(-c2nc3nc(N4CCC[C@H]4C(=O)N4CCN(CC(C)(F)F)CC4)nc(N)n3n2)o1 |
| InChI | InChI=1S/C21H27F2N9O2/c1-13-5-6-15(34-13)16-25-20-27-19(26-18(24)32(20)28-16)31-7-3-4-14(31)17(33)30-10-8-29(9-11-30)12-21(2,22)23/h5-6,14H,3-4,7-12H2,1-2H3,(H2,24,25,26,27,28)/t14-/m0/s1 |
| InChIKey | QPPCRVWEQPHDAL-AWEZNQCLSA-N |
| XLogP | 1.44 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |