C22H31N9O4 — CID 171744737
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[2-(2-methoxyethoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 171744737) has the molecular formula C22H31N9O4 and a molecular weight of 485.55 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[2-(2-methoxyethoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[2-(2-methoxyethoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171744737 |
| Molecular Formula | C22H31N9O4 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[2-(2-methoxyethoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | COCCOCCN1CCN(C(=O)[C@@H]2CCCN2c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C22H31N9O4/c1-33-14-15-34-13-11-28-7-9-29(10-8-28)19(32)16-4-2-6-30(16)21-25-20(23)31-22(26-21)24-18(27-31)17-5-3-12-35-17/h3,5,12,16H,2,4,6-11,13-15H2,1H3,(H2,23,24,25,26,27)/t16-/m0/s1 |
| InChIKey | GQKCHWNHORKHSO-INIZCTEOSA-N |
| XLogP | 0.14 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|