C19H19ClN8O — CID 11177363
5-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11177363) has the molecular formula C19H19ClN8O and a molecular weight of 410.87 g/mol. Its IUPAC name is 5-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11177363 |
| Molecular Formula | C19H19ClN8O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 5-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3cccc(Cl)c3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C19H19ClN8O/c20-14-4-1-3-13(11-14)12-26-6-8-27(9-7-26)18-23-17(21)28-19(24-18)22-16(25-28)15-5-2-10-29-15/h1-5,10-11H,6-9,12H2,(H2,21,22,23,24,25) |
| InChIKey | RTXQAEFEJZZDKI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |