C16H21AsN8O2 — CID 173102707
[8-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-1,2,3,4,6,7,9,9a-octahydropyrazino[1,2-a][1,3]azarsinin-3-yl]methanol (PubChem CID 173102707) has the molecular formula C16H21AsN8O2 and a molecular weight of 432.32 g/mol. Its IUPAC name is [8-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-1,2,3,4,6,7,9,9a-octahydropyrazino[1,2-a][1,3]azarsinin-3-yl]methanol.
| Compound Name | [8-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-1,2,3,4,6,7,9,9a-octahydropyrazino[1,2-a][1,3]azarsinin-3-yl]methanol |
|---|---|
| PubChem CID | 173102707 |
| Molecular Formula | C16H21AsN8O2 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [8-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-1,2,3,4,6,7,9,9a-octahydropyrazino[1,2-a][1,3]azarsinin-3-yl]methanol |
| SMILES | Nc1nc(N2CCN3CC(CO)C[AsH]C3C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C16H21AsN8O2/c18-14-20-15(21-16-19-13(22-25(14)16)11-2-1-5-27-11)24-4-3-23-7-10(9-26)6-17-12(23)8-24/h1-2,5,10,12,17,26H,3-4,6-9H2,(H2,18,19,20,21,22) |
| InChIKey | XDXRKYXMWYLSAU-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|