C24H30N2O4 — CID 118300921
tert-butyl 4-[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 118300921) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl 4-[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118300921 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl 4-[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)c2ccc(-c3ccco3)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C24H30N2O4/c1-24(2,3)30-23(28)25-14-12-20(13-15-25)26(19-10-11-19)22(27)18-8-6-17(7-9-18)21-5-4-16-29-21/h4-9,16,19-20H,10-15H2,1-3H3 |
| InChIKey | VPSXLRVUNJNVDJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |