C19H22FNO4 — CID 168526679
tert-butyl 3-[2-fluoro-4-(furan-2-yl)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 168526679) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is tert-butyl 3-[2-fluoro-4-(furan-2-yl)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-fluoro-4-(furan-2-yl)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168526679 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl 3-[2-fluoro-4-(furan-2-yl)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(-c3ccco3)cc2F)C1 |
| InChI | InChI=1S/C19H22FNO4/c1-19(2,3)25-18(22)21-9-8-14(12-21)24-17-7-6-13(11-15(17)20)16-5-4-10-23-16/h4-7,10-11,14H,8-9,12H2,1-3H3 |
| InChIKey | FRVSHYYTIPGCHC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |