C20H24FNO4 — CID 168526981
tert-butyl 4-[2-fluoro-6-(furan-2-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 168526981) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-6-(furan-2-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-6-(furan-2-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168526981 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | tert-butyl 4-[2-fluoro-6-(furan-2-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2c(F)cccc2-c2ccco2)CC1 |
| InChI | InChI=1S/C20H24FNO4/c1-20(2,3)26-19(23)22-11-9-14(10-12-22)25-18-15(6-4-7-16(18)21)17-8-5-13-24-17/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | SUWKNHRBJATCRC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |