C26H33N3O5S — CID 118300930
tert-butyl 4-[cyclopropyl-[4-(4-sulfamoylphenyl)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 118300930) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is tert-butyl 4-[cyclopropyl-[4-(4-sulfamoylphenyl)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[cyclopropyl-[4-(4-sulfamoylphenyl)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118300930 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | tert-butyl 4-[cyclopropyl-[4-(4-sulfamoylphenyl)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)c2ccc(-c3ccc(S(N)(=O)=O)cc3)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C26H33N3O5S/c1-26(2,3)34-25(31)28-16-14-22(15-17-28)29(21-10-11-21)24(30)20-6-4-18(5-7-20)19-8-12-23(13-9-19)35(27,32)33/h4-9,12-13,21-22H,10-11,14-17H2,1-3H3,(H2,27,32,33) |
| InChIKey | WXISPCUIRIOIFF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |