C20H24N8O3 — CID 155512576
tert-butyl 4-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]piperazine-1-carboxylate (PubChem CID 155512576) has the molecular formula C20H24N8O3 and a molecular weight of 424.47 g/mol. Its IUPAC name is tert-butyl 4-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155512576 |
| Molecular Formula | C20H24N8O3 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl 4-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]piperazine-1-carboxylate |
| SMILES | Cn1cc2c(nc(N3CCN(C(=O)OC(C)(C)C)CC3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H24N8O3/c1-20(2,3)31-19(29)27-9-7-26(8-10-27)18-22-15-13(12-25(4)23-15)17-21-16(24-28(17)18)14-6-5-11-30-14/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | AGFZTZOOZSHFHR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |