C18H25N5O3 — CID 167501698
tert-butyl 4-(7-carbamoyl-2-methylindazol-4-yl)piperazine-1-carboxylate (PubChem CID 167501698) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl 4-(7-carbamoyl-2-methylindazol-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-carbamoyl-2-methylindazol-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167501698 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | tert-butyl 4-(7-carbamoyl-2-methylindazol-4-yl)piperazine-1-carboxylate |
| SMILES | Cn1cc2c(N3CCN(C(=O)OC(C)(C)C)CC3)ccc(C(N)=O)c2n1 |
| InChI | InChI=1S/C18H25N5O3/c1-18(2,3)26-17(25)23-9-7-22(8-10-23)14-6-5-12(16(19)24)15-13(14)11-21(4)20-15/h5-6,11H,7-10H2,1-4H3,(H2,19,24) |
| InChIKey | VVBCZXCQSAODPA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |