C20H31N5O4 — CID 176741555
tert-butyl 4-[3-amino-4-carbamoyl-2-(2-methoxyethyliminomethyl)phenyl]piperazine-1-carboxylate (PubChem CID 176741555) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-carbamoyl-2-(2-methoxyethyliminomethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-carbamoyl-2-(2-methoxyethyliminomethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176741555 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | tert-butyl 4-[3-amino-4-carbamoyl-2-(2-methoxyethyliminomethyl)phenyl]piperazine-1-carboxylate |
| SMILES | COCC/N=C/c1c(N2CCN(C(=O)OC(C)(C)C)CC2)ccc(C(N)=O)c1N |
| InChI | InChI=1S/C20H31N5O4/c1-20(2,3)29-19(27)25-10-8-24(9-11-25)16-6-5-14(18(22)26)17(21)15(16)13-23-7-12-28-4/h5-6,13H,7-12,21H2,1-4H3,(H2,22,26)/b23-13+ |
| InChIKey | NQLCLOYNQYLIJF-YDZHTSKRSA-N |
| XLogP | 1.49 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|