C26H33ClN8O3 — CID 176741514
tert-butyl 4-[3-amino-4-[(8-chloro-2-methylimidazo[1,2-a]pyrazin-6-yl)carbamoyl]-2-(ethyliminomethyl)phenyl]piperazine-1-carboxylate (PubChem CID 176741514) has the molecular formula C26H33ClN8O3 and a molecular weight of 541.06 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-[(8-chloro-2-methylimidazo[1,2-a]pyrazin-6-yl)carbamoyl]-2-(ethyliminomethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-[(8-chloro-2-methylimidazo[1,2-a]pyrazin-6-yl)carbamoyl]-2-(ethyliminomethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176741514 |
| Molecular Formula | C26H33ClN8O3 |
| Molecular Weight | 541.06 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | tert-butyl 4-[3-amino-4-[(8-chloro-2-methylimidazo[1,2-a]pyrazin-6-yl)carbamoyl]-2-(ethyliminomethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC/N=C/c1c(N2CCN(C(=O)OC(C)(C)C)CC2)ccc(C(=O)Nc2cn3cc(C)nc3c(Cl)n2)c1N |
| InChI | InChI=1S/C26H33ClN8O3/c1-6-29-13-18-19(33-9-11-34(12-10-33)25(37)38-26(3,4)5)8-7-17(21(18)28)24(36)32-20-15-35-14-16(2)30-23(35)22(27)31-20/h7-8,13-15H,6,9-12,28H2,1-5H3,(H,32,36)/b29-13+ |
| InChIKey | MKLNNXPPTFGOAB-VFLNYLIXSA-N |
| XLogP | 4.02 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.06 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|