C21H30N4O5 — CID 176741633
tert-butyl 4-[3-amino-4-methoxycarbonyl-2-(oxetan-3-yliminomethyl)phenyl]piperazine-1-carboxylate (PubChem CID 176741633) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-methoxycarbonyl-2-(oxetan-3-yliminomethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-methoxycarbonyl-2-(oxetan-3-yliminomethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176741633 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | tert-butyl 4-[3-amino-4-methoxycarbonyl-2-(oxetan-3-yliminomethyl)phenyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(/C=N/C2COC2)c1N |
| InChI | InChI=1S/C21H30N4O5/c1-21(2,3)30-20(27)25-9-7-24(8-10-25)17-6-5-15(19(26)28-4)18(22)16(17)11-23-14-12-29-13-14/h5-6,11,14H,7-10,12-13,22H2,1-4H3/b23-11+ |
| InChIKey | FKGOGHKORFDOKR-FOKLQQMPSA-N |
| XLogP | 1.93 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|