C25H30FN7O3 — CID 176741539
tert-butyl 4-[3-amino-4-[(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)carbamoyl]-2-methanimidoylphenyl]piperazine-1-carboxylate (PubChem CID 176741539) has the molecular formula C25H30FN7O3 and a molecular weight of 495.56 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-[(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)carbamoyl]-2-methanimidoylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-[(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)carbamoyl]-2-methanimidoylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176741539 |
| Molecular Formula | C25H30FN7O3 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | tert-butyl 4-[3-amino-4-[(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)carbamoyl]-2-methanimidoylphenyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/c1c(N2CCN(C(=O)OC(C)(C)C)CC2)ccc(C(=O)Nc2cc(F)c3nc(C)cn3c2)c1N |
| InChI | InChI=1S/C25H30FN7O3/c1-15-13-33-14-16(11-19(26)22(33)29-15)30-23(34)17-5-6-20(18(12-27)21(17)28)31-7-9-32(10-8-31)24(35)36-25(2,3)4/h5-6,11-14,27H,7-10,28H2,1-4H3,(H,30,34)/b27-12+ |
| InChIKey | GRMLXOFILXDJCN-KKMKTNMSSA-N |
| XLogP | 3.67 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|