C21H24FN7O2 — CID 176741437
2-amino-N-[8-fluoro-2-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]-3-(methyliminomethyl)-4-piperazin-1-ylbenzamide (PubChem CID 176741437) has the molecular formula C21H24FN7O2 and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-amino-N-[8-fluoro-2-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]-3-(methyliminomethyl)-4-piperazin-1-ylbenzamide.
| Compound Name | 2-amino-N-[8-fluoro-2-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]-3-(methyliminomethyl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 176741437 |
| Molecular Formula | C21H24FN7O2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-amino-N-[8-fluoro-2-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]-3-(methyliminomethyl)-4-piperazin-1-ylbenzamide |
| SMILES | C/N=C/c1c(N2CCNCC2)ccc(C(=O)Nc2cc(F)c3nc(CO)cn3c2)c1N |
| InChI | InChI=1S/C21H24FN7O2/c1-24-9-16-18(28-6-4-25-5-7-28)3-2-15(19(16)23)21(31)27-13-8-17(22)20-26-14(12-30)11-29(20)10-13/h2-3,8-11,25,30H,4-7,12,23H2,1H3,(H,27,31)/b24-9+ |
| InChIKey | LKKYAYFXNYQQBB-PGGKNCGUSA-N |
| XLogP | 1.26 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|