C22H25FN6O — CID 170380599
2-amino-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-3-(methyliminomethyl)-4-piperidin-4-ylbenzamide (PubChem CID 170380599) has the molecular formula C22H25FN6O and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-amino-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-3-(methyliminomethyl)-4-piperidin-4-ylbenzamide.
| Compound Name | 2-amino-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-3-(methyliminomethyl)-4-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 170380599 |
| Molecular Formula | C22H25FN6O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-amino-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-3-(methyliminomethyl)-4-piperidin-4-ylbenzamide |
| SMILES | C/N=C/c1c(C2CCNCC2)ccc(C(=O)Nc2cc(F)c3nc(C)cn3c2)c1N |
| InChI | InChI=1S/C22H25FN6O/c1-13-11-29-12-15(9-19(23)21(29)27-13)28-22(30)17-4-3-16(14-5-7-26-8-6-14)18(10-25-2)20(17)24/h3-4,9-12,14,26H,5-8,24H2,1-2H3,(H,28,30)/b25-10+ |
| InChIKey | SIQVSAFHHBEFHF-KIBLKLHPSA-N |
| XLogP | 3.13 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|