C24H36N8O4 — CID 169243039
4-amino-6-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]pyrido[3,2-d]pyrimidine-8-carboxamide;tert-butyl piperidine-1-carboxylate (PubChem CID 169243039) has the molecular formula C24H36N8O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-amino-6-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]pyrido[3,2-d]pyrimidine-8-carboxamide;tert-butyl piperidine-1-carboxylate.
| Compound Name | 4-amino-6-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]pyrido[3,2-d]pyrimidine-8-carboxamide;tert-butyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169243039 |
| Molecular Formula | C24H36N8O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 4-amino-6-[(E)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]pyrido[3,2-d]pyrimidine-8-carboxamide;tert-butyl piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.COCC/N=C/C(=C\N)c1cc(C(N)=O)c2ncnc(N)c2n1 |
| InChI | InChI=1S/C14H17N7O2.C10H19NO2/c1-23-3-2-18-6-8(5-15)10-4-9(14(17)22)11-12(21-10)13(16)20-7-19-11;1-10(2,3)13-9(12)11-7-5-4-6-8-11/h4-7H,2-3,15H2,1H3,(H2,17,22)(H2,16,19,20);4-8H2,1-3H3/b8-5+,18-6+; |
| InChIKey | BRWMASCSKURWNU-KQECNEJESA-N |
| XLogP | 2.13 |
| TPSA | 184.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|