C23H30ClN5O2 — CID 144666174
tert-butyl 4-[2-[[3-amino-2-(6-chloro-1,5-naphthyridin-3-yl)prop-2-enylidene]amino]ethyl]piperidine-1-carboxylate (PubChem CID 144666174) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is tert-butyl 4-[2-[[3-amino-2-(6-chloro-1,5-naphthyridin-3-yl)prop-2-enylidene]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[3-amino-2-(6-chloro-1,5-naphthyridin-3-yl)prop-2-enylidene]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144666174 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl 4-[2-[[3-amino-2-(6-chloro-1,5-naphthyridin-3-yl)prop-2-enylidene]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC/N=C/C(=CN)c2cnc3ccc(Cl)nc3c2)CC1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-23(2,3)31-22(30)29-10-7-16(8-11-29)6-9-26-14-18(13-25)17-12-20-19(27-15-17)4-5-21(24)28-20/h4-5,12-16H,6-11,25H2,1-3H3/b18-13?,26-14+ |
| InChIKey | JZHUFENRGQBNQV-NIMCFLJRSA-N |
| XLogP | 4.69 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|