C18H21N7O — CID 71450242
N-cycloheptyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 71450242) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is N-cycloheptyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | N-cycloheptyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 71450242 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-cycloheptyl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | Cn1cc2c(nc(NC3CCCCCC3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C18H21N7O/c1-24-11-13-15(22-24)21-18(19-12-7-4-2-3-5-8-12)25-17(13)20-16(23-25)14-9-6-10-26-14/h6,9-12H,2-5,7-8H2,1H3,(H,19,21,22) |
| InChIKey | NNXMGTRINHPQFM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |