C23H30N8O2 — CID 11374351
1-[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pentylurea (PubChem CID 11374351) has the molecular formula C23H30N8O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 1-[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pentylurea.
| Compound Name | 1-[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pentylurea |
|---|---|
| PubChem CID | 11374351 |
| Molecular Formula | C23H30N8O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1nc2nn(CC3CCCCC3)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H30N8O2/c1-2-3-7-12-24-23(32)27-22-26-19-17(15-30(28-19)14-16-9-5-4-6-10-16)21-25-20(29-31(21)22)18-11-8-13-33-18/h8,11,13,15-16H,2-7,9-10,12,14H2,1H3,(H2,24,26,27,28,32) |
| InChIKey | WHASFBUGNOXFBW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|