C19H17N9O3 — CID 11711438
1-[4-(furan-2-yl)-11-(3-hydroxypropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-4-ylurea (PubChem CID 11711438) has the molecular formula C19H17N9O3 and a molecular weight of 419.41 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-(3-hydroxypropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-(furan-2-yl)-11-(3-hydroxypropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 11711438 |
| Molecular Formula | C19H17N9O3 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-(3-hydroxypropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)Nc1nc2nn(CCCO)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C19H17N9O3/c29-9-2-8-27-11-13-15(25-27)23-18(24-19(30)21-12-4-6-20-7-5-12)28-17(13)22-16(26-28)14-3-1-10-31-14/h1,3-7,10-11,29H,2,8-9H2,(H2,20,21,23,24,25,30) |
| InChIKey | GFZYPXHAEKVIKQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |