C28H32N10O5 — CID 140612767
tert-butyl N-[3-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]propyl]carbamate (PubChem CID 140612767) has the molecular formula C28H32N10O5 and a molecular weight of 588.63 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 140612767 |
| Molecular Formula | C28H32N10O5 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | tert-butyl N-[3-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]propyl]carbamate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)NCCCNC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C28H32N10O5/c1-28(2,3)43-27(41)30-13-6-12-29-21(39)15-17-8-10-18(11-9-17)31-26(40)34-25-33-22-19(16-37(4)35-22)24-32-23(36-38(24)25)20-7-5-14-42-20/h5,7-11,14,16H,6,12-13,15H2,1-4H3,(H,29,39)(H,30,41)(H2,31,33,34,35,40) |
| InChIKey | AZMDXIZWKRDPMI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|