C31H37N9O7 — CID 134132496
tert-butyl 5-[2-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]ethylperoxy]pentanoate (PubChem CID 134132496) has the molecular formula C31H37N9O7 and a molecular weight of 647.69 g/mol. Its IUPAC name is tert-butyl 5-[2-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]ethylperoxy]pentanoate.
| Compound Name | tert-butyl 5-[2-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]ethylperoxy]pentanoate |
|---|---|
| PubChem CID | 134132496 |
| Molecular Formula | C31H37N9O7 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | tert-butyl 5-[2-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]ethylperoxy]pentanoate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)NCCOOCCCCC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C31H37N9O7/c1-31(2,3)47-25(42)9-5-6-16-45-46-17-14-32-24(41)18-20-10-12-21(13-11-20)33-30(43)36-29-35-26-22(19-39(4)37-26)28-34-27(38-40(28)29)23-8-7-15-44-23/h7-8,10-13,15,19H,5-6,9,14,16-18H2,1-4H3,(H,32,41)(H2,33,35,36,37,43) |
| InChIKey | FBANBNAFWMJAME-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|