C18H16IN9O2 — CID 11497238
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-methylpyridin-1-ium-3-yl)urea iodide (PubChem CID 11497238) has the molecular formula C18H16IN9O2 and a molecular weight of 517.29 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-methylpyridin-1-ium-3-yl)urea iodide.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-methylpyridin-1-ium-3-yl)urea iodide |
|---|---|
| PubChem CID | 11497238 |
| Molecular Formula | C18H16IN9O2 |
| Molecular Weight | 517.29 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-methylpyridin-1-ium-3-yl)urea iodide |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc[n+](C)c3)n3nc(-c4ccco4)nc23)n1.[I-] |
| InChI | InChI=1S/C18H15N9O2.HI/c1-25-7-3-5-11(9-25)19-18(28)22-17-21-14-12(10-26(2)23-14)16-20-15(24-27(16)17)13-6-4-8-29-13;/h3-10H,1-2H3,(H-,19,21,22,23,28);1H |
| InChIKey | JLZITONHHHCGNY-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|