C27H22ClN7O2 — CID 45482074
2-(3-chlorophenyl)-N-[4-(furan-2-yl)-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]acetamide (PubChem CID 45482074) has the molecular formula C27H22ClN7O2 and a molecular weight of 511.97 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[4-(furan-2-yl)-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[4-(furan-2-yl)-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]acetamide |
|---|---|
| PubChem CID | 45482074 |
| Molecular Formula | C27H22ClN7O2 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[4-(furan-2-yl)-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)Nc1nc2nn(CCCc3ccccc3)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H22ClN7O2/c28-20-11-4-9-19(15-20)16-23(36)29-27-31-24-21(26-30-25(33-35(26)27)22-12-6-14-37-22)17-34(32-24)13-5-10-18-7-2-1-3-8-18/h1-4,6-9,11-12,14-15,17H,5,10,13,16H2,(H,29,31,32,36) |
| InChIKey | SYESLDXKRRTBBZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |