C21H18N8O — CID 71459268
4-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 71459268) has the molecular formula C21H18N8O and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 71459268 |
| Molecular Formula | C21H18N8O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | Cn1cc2c(nc(NCCc3c[nH]c4ccccc34)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H18N8O/c1-28-12-15-18(26-28)25-21(29-20(15)24-19(27-29)17-7-4-10-30-17)22-9-8-13-11-23-16-6-3-2-5-14(13)16/h2-7,10-12,23H,8-9H2,1H3,(H,22,25,26) |
| InChIKey | QCJSUMWNJLEJCF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |