C19H17N3O3 — CID 30850555
2-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 30850555) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 30850555 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(Cc1cc(-c2ccco2)on1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3O3/c23-19(11-14-10-18(25-22-14)17-6-3-9-24-17)20-8-7-13-12-21-16-5-2-1-4-15(13)16/h1-6,9-10,12,21H,7-8,11H2,(H,20,23) |
| InChIKey | QGBLOUUONYZOQE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |