C19H17N5O2 — CID 11416733
2-amino-6-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4-carboxamide (PubChem CID 11416733) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-amino-6-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 2-amino-6-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 11416733 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-amino-6-(furan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4-carboxamide |
| SMILES | Nc1nc(C(=O)NCCc2c[nH]c3ccccc23)cc(-c2ccco2)n1 |
| InChI | InChI=1S/C19H17N5O2/c20-19-23-15(17-6-3-9-26-17)10-16(24-19)18(25)21-8-7-12-11-22-14-5-2-1-4-13(12)14/h1-6,9-11,22H,7-8H2,(H,21,25)(H2,20,23,24) |
| InChIKey | LIKHFOAAZJKMSS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |