C19H26N8O3 — CID 69434916
tert-butyl 2-[[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 69434916) has the molecular formula C19H26N8O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is tert-butyl 2-[[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69434916 |
| Molecular Formula | C19H26N8O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl 2-[[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNc1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C19H26N8O3/c1-19(2,3)30-18(28)26-9-5-4-7-12(26)11-21-16-23-15(20)27-17(24-16)22-14(25-27)13-8-6-10-29-13/h6,8,10,12H,4-5,7,9,11H2,1-3H3,(H3,20,21,22,23,24,25) |
| InChIKey | SBQFFCUPHIFGMU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |