C21H19ClF4N8O — CID 69433681
5-N-[[1-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 69433681) has the molecular formula C21H19ClF4N8O and a molecular weight of 510.88 g/mol. Its IUPAC name is 5-N-[[1-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-[[1-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 69433681 |
| Molecular Formula | C21H19ClF4N8O |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 5-N-[[1-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NCC2CCCN2Cc2c(C(F)(F)F)ccc(Cl)c2F)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C21H19ClF4N8O/c22-14-6-5-13(21(24,25)26)12(16(14)23)10-33-7-1-3-11(33)9-28-19-30-18(27)34-20(31-19)29-17(32-34)15-4-2-8-35-15/h2,4-6,8,11H,1,3,7,9-10H2,(H3,27,28,29,30,31,32) |
| InChIKey | SSQZOVQSQZHOQS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |