C22H21F4N7O — CID 11751869
2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (PubChem CID 11751869) has the molecular formula C22H21F4N7O and a molecular weight of 475.45 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 11751869 |
| Molecular Formula | C22H21F4N7O |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| SMILES | CN(CC1CCCN1Cc1c(F)c(F)cc(F)c1F)c1cc2nc(-c3ccco3)nn2c(N)n1 |
| InChI | InChI=1S/C22H21F4N7O/c1-31(17-9-18-28-21(16-5-3-7-34-16)30-33(18)22(27)29-17)10-12-4-2-6-32(12)11-13-19(25)14(23)8-15(24)20(13)26/h3,5,7-9,12H,2,4,6,10-11H2,1H3,(H2,27,29) |
| InChIKey | CCVDJJYXSRAHRD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|