C23H24F3N7O — CID 11351899
2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,6-trifluorophenyl)methyl]piperidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (PubChem CID 11351899) has the molecular formula C23H24F3N7O and a molecular weight of 471.49 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,6-trifluorophenyl)methyl]piperidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,6-trifluorophenyl)methyl]piperidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 11351899 |
| Molecular Formula | C23H24F3N7O |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-(furan-2-yl)-7-N-methyl-7-N-[[1-[(2,3,6-trifluorophenyl)methyl]piperidin-2-yl]methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| SMILES | CN(CC1CCCCN1Cc1c(F)ccc(F)c1F)c1cc2nc(-c3ccco3)nn2c(N)n1 |
| InChI | InChI=1S/C23H24F3N7O/c1-31(19-11-20-28-22(18-6-4-10-34-18)30-33(20)23(27)29-19)12-14-5-2-3-9-32(14)13-15-16(24)7-8-17(25)21(15)26/h4,6-8,10-11,14H,2-3,5,9,12-13H2,1H3,(H2,27,29) |
| InChIKey | DPISPPQYLIRXDO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|