C18H19ClN8O2 — CID 11316898
5-N-[[(2R)-1-[(5-chlorofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 11316898) has the molecular formula C18H19ClN8O2 and a molecular weight of 414.86 g/mol. Its IUPAC name is 5-N-[[(2R)-1-[(5-chlorofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-[[(2R)-1-[(5-chlorofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 11316898 |
| Molecular Formula | C18H19ClN8O2 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-N-[[(2R)-1-[(5-chlorofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NC[C@H]2CCCN2Cc2ccc(Cl)o2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H19ClN8O2/c19-14-6-5-12(29-14)10-26-7-1-3-11(26)9-21-17-23-16(20)27-18(24-17)22-15(25-27)13-4-2-8-28-13/h2,4-6,8,11H,1,3,7,9-10H2,(H3,20,21,22,23,24,25)/t11-/m1/s1 |
| InChIKey | OVXMBPFNWCSOMP-LLVKDONJSA-N |
| XLogP | 2.68 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |