C18H21ClN10O — CID 69431050
5-N-[[1-[1-(5-chloro-1H-pyrazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 69431050) has the molecular formula C18H21ClN10O and a molecular weight of 428.89 g/mol. Its IUPAC name is 5-N-[[1-[1-(5-chloro-1H-pyrazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-[[1-[1-(5-chloro-1H-pyrazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 69431050 |
| Molecular Formula | C18H21ClN10O |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 5-N-[[1-[1-(5-chloro-1H-pyrazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | CC(c1cn[nH]c1Cl)N1CCCC1CNc1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C18H21ClN10O/c1-10(12-9-22-26-14(12)19)28-6-2-4-11(28)8-21-17-24-16(20)29-18(25-17)23-15(27-29)13-5-3-7-30-13/h3,5,7,9-11H,2,4,6,8H2,1H3,(H,22,26)(H3,20,21,23,24,25,27) |
| InChIKey | MZHAHSAYIZLGMX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |