C20H19N7O3 — CID 166765590
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-methoxy-2-phenylpropan-1-ol (PubChem CID 166765590) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-methoxy-2-phenylpropan-1-ol.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-methoxy-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 166765590 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-methoxy-2-phenylpropan-1-ol |
| SMILES | COC(O)C(C)(c1ccccc1)n1cc2c(nc(N)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H19N7O3/c1-20(18(28)29-2,12-7-4-3-5-8-12)26-11-13-15(24-26)23-19(21)27-17(13)22-16(25-27)14-9-6-10-30-14/h3-11,18,28H,1-2H3,(H2,21,23,24) |
| InChIKey | VIABKEGFHIWEIE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|