C21H18N5OS+ — CID 7644105
13-benzyl-4-(furan-2-yl)-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 7644105) has the molecular formula C21H18N5OS+ and a molecular weight of 388.48 g/mol. Its IUPAC name is 13-benzyl-4-(furan-2-yl)-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 13-benzyl-4-(furan-2-yl)-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 7644105 |
| Molecular Formula | C21H18N5OS+ |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 13-benzyl-4-(furan-2-yl)-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | c1ccc(C[NH+]2CCc3c(sc4ncn5nc(-c6ccco6)nc5c34)C2)cc1 |
| InChI | InChI=1S/C21H17N5OS/c1-2-5-14(6-3-1)11-25-9-8-15-17(12-25)28-21-18(15)20-23-19(16-7-4-10-27-16)24-26(20)13-22-21/h1-7,10,13H,8-9,11-12H2/p+1 |
| InChIKey | BPWYIGTWZUHPSP-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |