C15H12N4OS — CID 7674442
5-(furan-2-yl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 7674442) has the molecular formula C15H12N4OS and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-(furan-2-yl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 5-(furan-2-yl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 7674442 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-(furan-2-yl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | c1coc(-c2nnc3c4c5c(sc4ncn23)CCCC5)c1 |
| InChI | InChI=1S/C15H12N4OS/c1-2-6-11-9(4-1)12-14-18-17-13(10-5-3-7-20-10)19(14)8-16-15(12)21-11/h3,5,7-8H,1-2,4,6H2 |
| InChIKey | QBUPHNIVLODYLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |