C13H11N5S2 — CID 3167609
2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetonitrile (PubChem CID 3167609) has the molecular formula C13H11N5S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetonitrile.
| Compound Name | 2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetonitrile |
|---|---|
| PubChem CID | 3167609 |
| Molecular Formula | C13H11N5S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetonitrile |
| SMILES | N#CCSc1nnc2c3c4c(sc3ncn12)CCCC4 |
| InChI | InChI=1S/C13H11N5S2/c14-5-6-19-13-17-16-11-10-8-3-1-2-4-9(8)20-12(10)15-7-18(11)13/h7H,1-4,6H2 |
| InChIKey | DPYWISHSKGHAQF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |