C22H23N5OS2 — CID 22425670
N-(3-phenylpropyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide (PubChem CID 22425670) has the molecular formula C22H23N5OS2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22425670 |
| Molecular Formula | C22H23N5OS2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(3-phenylpropyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c3c4c(sc3ncn12)CCCC4)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H23N5OS2/c28-18(23-12-6-9-15-7-2-1-3-8-15)13-29-22-26-25-20-19-16-10-4-5-11-17(16)30-21(19)24-14-27(20)22/h1-3,7-8,14H,4-6,9-13H2,(H,23,28) |
| InChIKey | KFTZOYNNZCJXGU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|