C23H25N5OS2 — CID 3203849
2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 3203849) has the molecular formula C23H25N5OS2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3203849 |
| Molecular Formula | C23H25N5OS2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | CCc1nc2sc3c(c2c2nnc(SCC(=O)NCCc4ccccc4)n12)CCCC3 |
| InChI | InChI=1S/C23H25N5OS2/c1-2-18-25-22-20(16-10-6-7-11-17(16)31-22)21-26-27-23(28(18)21)30-14-19(29)24-13-12-15-8-4-3-5-9-15/h3-5,8-9H,2,6-7,10-14H2,1H3,(H,24,29) |
| InChIKey | PRMWOMLQVSZVEI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |